C11H23NO3 — CID 82330162
3-[3-hydroxypropyl(2-methylpropyl)amino]-2-methylpropanoic acid (PubChem CID 82330162) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-[3-hydroxypropyl(2-methylpropyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[3-hydroxypropyl(2-methylpropyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82330162 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 3-[3-hydroxypropyl(2-methylpropyl)amino]-2-methylpropanoic acid |
| SMILES | CC(C)CN(CCCO)CC(C)C(=O)O |
| InChI | InChI=1S/C11H23NO3/c1-9(2)7-12(5-4-6-13)8-10(3)11(14)15/h9-10,13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | ZQEBXCAANLDTNX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |