C9H16N2O3 — CID 82328543
3-[cyanomethyl(3-hydroxypropyl)amino]-2-methylpropanoic acid (PubChem CID 82328543) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-[cyanomethyl(3-hydroxypropyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[cyanomethyl(3-hydroxypropyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82328543 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-[cyanomethyl(3-hydroxypropyl)amino]-2-methylpropanoic acid |
| SMILES | CC(CN(CC#N)CCCO)C(=O)O |
| InChI | InChI=1S/C9H16N2O3/c1-8(9(13)14)7-11(5-3-10)4-2-6-12/h8,12H,2,4-7H2,1H3,(H,13,14) |
| InChIKey | NNNLFABFWITYJR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|