C14H25NO5 — CID 82323914
3-[3-carboxypropyl(2-ethylbutanoyl)amino]-2-methylpropanoic acid (PubChem CID 82323914) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-[3-carboxypropyl(2-ethylbutanoyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[3-carboxypropyl(2-ethylbutanoyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82323914 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 3-[3-carboxypropyl(2-ethylbutanoyl)amino]-2-methylpropanoic acid |
| SMILES | CCC(CC)C(=O)N(CCCC(=O)O)CC(C)C(=O)O |
| InChI | InChI=1S/C14H25NO5/c1-4-11(5-2)13(18)15(8-6-7-12(16)17)9-10(3)14(19)20/h10-11H,4-9H2,1-3H3,(H,16,17)(H,19,20) |
| InChIKey | GXSFMSAJYWLEFG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |