C13H25NO4 — CID 82323893
3-[2-ethylbutanoyl(2-hydroxypropyl)amino]-2-methylpropanoic acid (PubChem CID 82323893) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-[2-ethylbutanoyl(2-hydroxypropyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[2-ethylbutanoyl(2-hydroxypropyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82323893 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 3-[2-ethylbutanoyl(2-hydroxypropyl)amino]-2-methylpropanoic acid |
| SMILES | CCC(CC)C(=O)N(CC(C)O)CC(C)C(=O)O |
| InChI | InChI=1S/C13H25NO4/c1-5-11(6-2)12(16)14(8-10(4)15)7-9(3)13(17)18/h9-11,15H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | JDVNMVQGLPNFAJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |