C25H37F3O2 — CID 143909116
(7Z,15E)-7,8,16-trifluoro-17-methoxy-5,10,13-trimethyl-6,9,14-trimethylideneoctadeca-7,15,17-trien-2-ol (PubChem CID 143909116) has the molecular formula C25H37F3O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is (7Z,15E)-7,8,16-trifluoro-17-methoxy-5,10,13-trimethyl-6,9,14-trimethylideneoctadeca-7,15,17-trien-2-ol.
| Compound Name | (7Z,15E)-7,8,16-trifluoro-17-methoxy-5,10,13-trimethyl-6,9,14-trimethylideneoctadeca-7,15,17-trien-2-ol |
|---|---|
| PubChem CID | 143909116 |
| Molecular Formula | C25H37F3O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | (7Z,15E)-7,8,16-trifluoro-17-methoxy-5,10,13-trimethyl-6,9,14-trimethylideneoctadeca-7,15,17-trien-2-ol |
| SMILES | C=C(OC)/C(F)=C\C(=C)C(C)CCC(C)C(=C)/C(F)=C(/F)C(=C)C(C)CCC(C)O |
| InChI | InChI=1S/C25H37F3O2/c1-15(18(4)14-23(26)22(8)30-9)10-11-16(2)20(6)24(27)25(28)21(7)17(3)12-13-19(5)29/h14-17,19,29H,4,6-8,10-13H2,1-3,5,9H3/b23-14+,25-24- |
| InChIKey | XQYHBIPJCITKEB-HVNIOBLQSA-N |
| XLogP | 7.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|