About (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane
(3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane (PubChem CID 145298574) has the molecular formula C17H30F2O2
and a molecular weight of 304.42 g/mol. Its IUPAC name is (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane.
Molecular Properties
| Compound Name | (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane |
| PubChem CID | 145298574 |
| Molecular Formula | C17H30F2O2 |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)C(C)COC(C)CC.CCC |
| InChI | InChI=1S/C14H22F2O2.C3H8/c1-7-10(3)18-8-9(2)11(4)13(15)14(16)12(5)17-6;1-3-2/h9-10H,4-5,7-8H2,1-3,6H3;3H2,1-2H3/b14-13-; |
| InChIKey | HGPNLXINCLMVOW-HPWRNOGASA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane?
The IUPAC name of (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane (CID 145298574) is (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane.
What is the SMILES notation for (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane?
The canonical SMILES for (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane is C=C(OC)/C(F)=C(/F)C(=C)C(C)COC(C)CC.CCC.
What is the InChIKey of (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane?
The InChIKey is HGPNLXINCLMVOW-HPWRNOGASA-N. The full InChI is InChI=1S/C14H22F2O2.C3H8/c1-7-10(3)18-8-9(2)11(4)13(15)14(16)12(5)17-6;1-3-2/h9-10H,4-5,7-8H2,1-3,6H3;3H2,1-2H3/b14-13-;.
What are the key properties of (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane?
(3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane has a molecular weight of 304.42 g/mol, XLogP of 5.72, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane is sourced from PubChem (CID 145298574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).