C17H30F2O2 — CID 145298574
(3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane (PubChem CID 145298574) has the molecular formula C17H30F2O2 and a molecular weight of 304.42 g/mol. Its IUPAC name is (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane.
| Compound Name | (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane |
|---|---|
| PubChem CID | 145298574 |
| Molecular Formula | C17H30F2O2 |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (3Z)-7-butan-2-yloxy-3,4-difluoro-2-methoxy-6-methyl-5-methylidenehepta-1,3-diene;propane |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)C(C)COC(C)CC.CCC |
| InChI | InChI=1S/C14H22F2O2.C3H8/c1-7-10(3)18-8-9(2)11(4)13(15)14(16)12(5)17-6;1-3-2/h9-10H,4-5,7-8H2,1-3,6H3;3H2,1-2H3/b14-13-; |
| InChIKey | HGPNLXINCLMVOW-HPWRNOGASA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|