C19H25F3O2 — CID 143875384
(3E,11Z)-4,11,12-trifluoro-13-methoxy-6,9-dimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraen-2-ol (PubChem CID 143875384) has the molecular formula C19H25F3O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (3E,11Z)-4,11,12-trifluoro-13-methoxy-6,9-dimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraen-2-ol.
| Compound Name | (3E,11Z)-4,11,12-trifluoro-13-methoxy-6,9-dimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraen-2-ol |
|---|---|
| PubChem CID | 143875384 |
| Molecular Formula | C19H25F3O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (3E,11Z)-4,11,12-trifluoro-13-methoxy-6,9-dimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraen-2-ol |
| SMILES | C=C(O)/C=C(/F)C(=C)C(C)CCC(C)C(=C)/C(F)=C(/F)C(=C)OC |
| InChI | InChI=1S/C19H25F3O2/c1-11(14(4)17(20)10-13(3)23)8-9-12(2)15(5)18(21)19(22)16(6)24-7/h10-12,23H,3-6,8-9H2,1-2,7H3/b17-10+,19-18- |
| InChIKey | PXKGFZLFELJQGT-JAIPTJSISA-N |
| XLogP | 6.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|