C26H46F2 — CID 143777022
(Z)-7,8-difluoro-2,5,10,13,14,17-hexamethyl-6,9-dimethylideneoctadec-7-ene (PubChem CID 143777022) has the molecular formula C26H46F2 and a molecular weight of 396.65 g/mol. Its IUPAC name is (Z)-7,8-difluoro-2,5,10,13,14,17-hexamethyl-6,9-dimethylideneoctadec-7-ene.
| Compound Name | (Z)-7,8-difluoro-2,5,10,13,14,17-hexamethyl-6,9-dimethylideneoctadec-7-ene |
|---|---|
| PubChem CID | 143777022 |
| Molecular Formula | C26H46F2 |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.36 |
| IUPAC Name | (Z)-7,8-difluoro-2,5,10,13,14,17-hexamethyl-6,9-dimethylideneoctadec-7-ene |
| SMILES | C=C(/C(F)=C(/F)C(=C)C(C)CCC(C)C(C)CCC(C)C)C(C)CCC(C)C |
| InChI | InChI=1S/C26H46F2/c1-17(2)11-13-19(5)20(6)15-16-22(8)24(10)26(28)25(27)23(9)21(7)14-12-18(3)4/h17-22H,9-16H2,1-8H3/b26-25- |
| InChIKey | GTSTWULAAWCMKD-QPLCGJKRSA-N |
| XLogP | 9.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|