About CID 173481307
CID 173481307 (PubChem CID 173481307) has the molecular formula C11H21B
and a molecular weight of 164.10 g/mol.
Molecular Properties
| Compound Name | CID 173481307 |
| PubChem CID | 173481307 |
| Molecular Formula | C11H21B |
| Molecular Weight | 164.10 g/mol |
| Exact Mass | 164.17 |
| IUPAC Name | — |
| SMILES | [B]C(C)C(=C)C(C)CCC(C)C |
| InChI | InChI=1S/C11H21B/c1-8(2)6-7-9(3)10(4)11(5)12/h8-9,11H,4,6-7H2,1-3,5H3 |
| InChIKey | DMPYXPKXNHCHOU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 173481307 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173481307?
The IUPAC name of CID 173481307 (CID 173481307) is not available.
What is the SMILES notation for CID 173481307?
The canonical SMILES for CID 173481307 is [B]C(C)C(=C)C(C)CCC(C)C.
What is the InChIKey of CID 173481307?
The InChIKey is DMPYXPKXNHCHOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21B/c1-8(2)6-7-9(3)10(4)11(5)12/h8-9,11H,4,6-7H2,1-3,5H3.
What are the key properties of CID 173481307?
CID 173481307 has a molecular weight of 164.10 g/mol, XLogP of 3.59, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173481307 is sourced from PubChem (CID 173481307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).