C19H28 — CID 143727055
(3Z,7Z)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene (PubChem CID 143727055) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is (3Z,7Z)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene.
| Compound Name | (3Z,7Z)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene |
|---|---|
| PubChem CID | 143727055 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | (3Z,7Z)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene |
| SMILES | C=C/C=C\C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)C |
| InChI | InChI=1S/C19H28/c1-8-9-10-16(4)18(6)13-14-19(7)17(5)12-11-15(2)3/h8-10,13-15,17H,1,4,6-7,11-12H2,2-3,5H3/b10-9-,14-13- |
| InChIKey | AZCPVVTZBTVWRX-KWUOUXIESA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|