C21H30 — CID 145009658
(3Z,7Z)-2,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,14-tetraene (PubChem CID 145009658) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is (3Z,7Z)-2,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,14-tetraene.
| Compound Name | (3Z,7Z)-2,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,14-tetraene |
|---|---|
| PubChem CID | 145009658 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | (3Z,7Z)-2,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,14-tetraene |
| SMILES | C=CC(C)CCC(C)C(=C)/C=C\C(=C)C(=C)/C=C\C(=C)C |
| InChI | InChI=1S/C21H30/c1-9-17(4)11-13-19(6)21(8)15-14-20(7)18(5)12-10-16(2)3/h9-10,12,14-15,17,19H,1-2,5,7-8,11,13H2,3-4,6H3/b12-10-,15-14- |
| InChIKey | XEQQJGWAZYHMJQ-CWXQJLEJSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|