C21H30 — CID 145464220
[(8Z)-3,6,10-trimethyl-7-methylideneundeca-8,10-dienyl]benzene (PubChem CID 145464220) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is [(8Z)-3,6,10-trimethyl-7-methylideneundeca-8,10-dienyl]benzene.
| Compound Name | [(8Z)-3,6,10-trimethyl-7-methylideneundeca-8,10-dienyl]benzene |
|---|---|
| PubChem CID | 145464220 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | [(8Z)-3,6,10-trimethyl-7-methylideneundeca-8,10-dienyl]benzene |
| SMILES | C=C(C)/C=C\C(=C)C(C)CCC(C)CCc1ccccc1 |
| InChI | InChI=1S/C21H30/c1-17(2)11-14-19(4)20(5)15-12-18(3)13-16-21-9-7-6-8-10-21/h6-11,14,18,20H,1,4,12-13,15-16H2,2-3,5H3/b14-11- |
| InChIKey | WOMPIKXPJAHIIW-KAMYIIQDSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|