C14H20O2 — CID 174481116
2,4-dimethyl-6-phenylhexanoic acid (PubChem CID 174481116) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 2,4-dimethyl-6-phenylhexanoic acid.
| Compound Name | 2,4-dimethyl-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 174481116 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2,4-dimethyl-6-phenylhexanoic acid |
| SMILES | CC(CCc1ccccc1)CC(C)C(=O)O |
| InChI | InChI=1S/C14H20O2/c1-11(10-12(2)14(15)16)8-9-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3,(H,15,16) |
| InChIKey | WXWBTWQGWJYVNS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |