C14H22S — CID 130460401
(3Z)-5-methylidene-6-(4-methylpentylsulfanyl)hepta-1,3,6-triene (PubChem CID 130460401) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is (3Z)-5-methylidene-6-(4-methylpentylsulfanyl)hepta-1,3,6-triene.
| Compound Name | (3Z)-5-methylidene-6-(4-methylpentylsulfanyl)hepta-1,3,6-triene |
|---|---|
| PubChem CID | 130460401 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3Z)-5-methylidene-6-(4-methylpentylsulfanyl)hepta-1,3,6-triene |
| SMILES | C=C/C=C\C(=C)C(=C)SCCCC(C)C |
| InChI | InChI=1S/C14H22S/c1-6-7-10-13(4)14(5)15-11-8-9-12(2)3/h6-7,10,12H,1,4-5,8-9,11H2,2-3H3/b10-7- |
| InChIKey | DHTLCLKOEATJQS-YFHOEESVSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|