C26H47FO — CID 145234988
(E)-11-fluoro-5,6,9,14,17-pentamethyl-10,13-dimethylidenenonadec-11-en-2-ol (PubChem CID 145234988) has the molecular formula C26H47FO and a molecular weight of 394.66 g/mol. Its IUPAC name is (E)-11-fluoro-5,6,9,14,17-pentamethyl-10,13-dimethylidenenonadec-11-en-2-ol.
| Compound Name | (E)-11-fluoro-5,6,9,14,17-pentamethyl-10,13-dimethylidenenonadec-11-en-2-ol |
|---|---|
| PubChem CID | 145234988 |
| Molecular Formula | C26H47FO |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | (E)-11-fluoro-5,6,9,14,17-pentamethyl-10,13-dimethylidenenonadec-11-en-2-ol |
| SMILES | C=C(/C=C(/F)C(=C)C(C)CCC(C)C(C)CCC(C)O)C(C)CCC(C)CC |
| InChI | InChI=1S/C26H47FO/c1-10-18(2)11-12-21(5)23(7)17-26(27)25(9)22(6)14-13-19(3)20(4)15-16-24(8)28/h17-22,24,28H,7,9-16H2,1-6,8H3/b26-17+ |
| InChIKey | OHNGDGIBROVKJC-YZSQISJMSA-N |
| XLogP | 8.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|