C25H37FO2 — CID 145122796
[(2E,6E)-2-but-1-en-2-yl-6-fluoro-9,12-dimethyl-4,5,8-trimethylidenetetradeca-2,6-dienyl] acetate (PubChem CID 145122796) has the molecular formula C25H37FO2 and a molecular weight of 388.57 g/mol. Its IUPAC name is [(2E,6E)-2-but-1-en-2-yl-6-fluoro-9,12-dimethyl-4,5,8-trimethylidenetetradeca-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-2-but-1-en-2-yl-6-fluoro-9,12-dimethyl-4,5,8-trimethylidenetetradeca-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 145122796 |
| Molecular Formula | C25H37FO2 |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | [(2E,6E)-2-but-1-en-2-yl-6-fluoro-9,12-dimethyl-4,5,8-trimethylidenetetradeca-2,6-dienyl] acetate |
| SMILES | C=C(/C=C(/COC(C)=O)C(=C)CC)C(=C)/C(F)=C/C(=C)C(C)CCC(C)CC |
| InChI | InChI=1S/C25H37FO2/c1-10-17(3)12-13-19(5)20(6)15-25(26)22(8)21(7)14-24(18(4)11-2)16-28-23(9)27/h14-15,17,19H,4,6-8,10-13,16H2,1-3,5,9H3/b24-14-,25-15+ |
| InChIKey | SPGOWRJDARSKBU-WJVNUPORSA-N |
| XLogP | 7.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|