C24H35FO — CID 145122426
(3Z,7E,11Z)-3-but-1-en-2-yl-7-fluoro-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trien-1-ol (PubChem CID 145122426) has the molecular formula C24H35FO and a molecular weight of 358.54 g/mol. Its IUPAC name is (3Z,7E,11Z)-3-but-1-en-2-yl-7-fluoro-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trien-1-ol.
| Compound Name | (3Z,7E,11Z)-3-but-1-en-2-yl-7-fluoro-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trien-1-ol |
|---|---|
| PubChem CID | 145122426 |
| Molecular Formula | C24H35FO |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (3Z,7E,11Z)-3-but-1-en-2-yl-7-fluoro-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trien-1-ol |
| SMILES | C=C(/C=C(\CCO)C(=C)CC)C(=C)/C(F)=C\C(=C)C(C)/C=C\C(C)CC |
| InChI | InChI=1S/C24H35FO/c1-9-17(3)11-12-19(5)20(6)16-24(25)22(8)21(7)15-23(13-14-26)18(4)10-2/h11-12,15-17,19,26H,4,6-10,13-14H2,1-3,5H3/b12-11-,23-15-,24-16+ |
| InChIKey | QCWWZZVHGZINCN-NDCKSUFMSA-N |
| XLogP | 7.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|