C31H48O2 — CID 145122413
(4Z,8Z,12Z)-8-ethyl-4-(2-methoxyethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;2-methylprop-2-enal (PubChem CID 145122413) has the molecular formula C31H48O2 and a molecular weight of 452.72 g/mol. Its IUPAC name is (4Z,8Z,12Z)-8-ethyl-4-(2-methoxyethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;2-methylprop-2-enal.
| Compound Name | (4Z,8Z,12Z)-8-ethyl-4-(2-methoxyethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145122413 |
| Molecular Formula | C31H48O2 |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | (4Z,8Z,12Z)-8-ethyl-4-(2-methoxyethyl)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;2-methylprop-2-enal |
| SMILES | C=C(/C=C(/CCOC)C(=C)CC)C(=C)/C(=C/C(=C)C(C)/C=C\C(C)CC)CC.C=C(C)C=O |
| InChI | InChI=1S/C27H42O.C4H6O/c1-11-20(4)14-15-22(6)23(7)18-26(13-3)25(9)24(8)19-27(16-17-28-10)21(5)12-2;1-4(2)3-5/h14-15,18-20,22H,5,7-9,11-13,16-17H2,1-4,6,10H3;3H,1H2,2H3/b15-14-,26-18-,27-19-; |
| InChIKey | SYGSNPZDYCUPRW-BMJZYIKPSA-N |
| XLogP | 8.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|