C18H22F4O2 — CID 145420672
(4Z,8Z)-4,5,8,9-tetrafluoro-1,12-dimethoxy-3,6,7,10-tetramethylidenedodeca-4,8-diene (PubChem CID 145420672) has the molecular formula C18H22F4O2 and a molecular weight of 346.36 g/mol. Its IUPAC name is (4Z,8Z)-4,5,8,9-tetrafluoro-1,12-dimethoxy-3,6,7,10-tetramethylidenedodeca-4,8-diene.
| Compound Name | (4Z,8Z)-4,5,8,9-tetrafluoro-1,12-dimethoxy-3,6,7,10-tetramethylidenedodeca-4,8-diene |
|---|---|
| PubChem CID | 145420672 |
| Molecular Formula | C18H22F4O2 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (4Z,8Z)-4,5,8,9-tetrafluoro-1,12-dimethoxy-3,6,7,10-tetramethylidenedodeca-4,8-diene |
| SMILES | C=C(CCOC)/C(F)=C(/F)C(=C)C(=C)/C(F)=C(\F)C(=C)CCOC |
| InChI | InChI=1S/C18H22F4O2/c1-11(7-9-23-5)15(19)17(21)13(3)14(4)18(22)16(20)12(2)8-10-24-6/h1-4,7-10H2,5-6H3/b17-15-,18-16- |
| InChIKey | XCHFGOFINQRUJW-IQRFGFHNSA-N |
| XLogP | 5.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|