C18H22F4O2 — CID 145420651
(3Z,7Z)-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylidene-2-propoxyundeca-1,3,7-triene (PubChem CID 145420651) has the molecular formula C18H22F4O2 and a molecular weight of 346.36 g/mol. Its IUPAC name is (3Z,7Z)-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylidene-2-propoxyundeca-1,3,7-triene.
| Compound Name | (3Z,7Z)-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylidene-2-propoxyundeca-1,3,7-triene |
|---|---|
| PubChem CID | 145420651 |
| Molecular Formula | C18H22F4O2 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (3Z,7Z)-3,4,7,8-tetrafluoro-11-methoxy-5,6,9-trimethylidene-2-propoxyundeca-1,3,7-triene |
| SMILES | C=C(CCOC)/C(F)=C(/F)C(=C)C(=C)/C(F)=C(\F)C(=C)OCCC |
| InChI | InChI=1S/C18H22F4O2/c1-7-9-24-14(5)18(22)17(21)13(4)12(3)16(20)15(19)11(2)8-10-23-6/h2-5,7-10H2,1,6H3/b16-15-,18-17- |
| InChIKey | CVJWPZBEYOGSTN-IUILNFPDSA-N |
| XLogP | 5.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|