About 1-methoxypropane;methyl propyl carbonate
1-methoxypropane;methyl propyl carbonate (PubChem CID 159112216) has the molecular formula C9H20O4
and a molecular weight of 192.25 g/mol. Its IUPAC name is 1-methoxypropane;methyl propyl carbonate.
Molecular Properties
| Compound Name | 1-methoxypropane;methyl propyl carbonate |
| PubChem CID | 159112216 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-methoxypropane;methyl propyl carbonate |
| SMILES | CCCOC.CCCOC(=O)OC |
| InChI | InChI=1S/C5H10O3.C4H10O/c1-3-4-8-5(6)7-2;1-3-4-5-2/h3-4H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | KEQGWZHHDPEOMB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methoxypropane;methyl propyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropane;methyl propyl carbonate?
The IUPAC name of 1-methoxypropane;methyl propyl carbonate (CID 159112216) is 1-methoxypropane;methyl propyl carbonate.
What is the SMILES notation for 1-methoxypropane;methyl propyl carbonate?
The canonical SMILES for 1-methoxypropane;methyl propyl carbonate is CCCOC.CCCOC(=O)OC.
What is the InChIKey of 1-methoxypropane;methyl propyl carbonate?
The InChIKey is KEQGWZHHDPEOMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C4H10O/c1-3-4-8-5(6)7-2;1-3-4-5-2/h3-4H2,1-2H3;3-4H2,1-2H3.
What are the key properties of 1-methoxypropane;methyl propyl carbonate?
1-methoxypropane;methyl propyl carbonate has a molecular weight of 192.25 g/mol, XLogP of 2.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropane;methyl propyl carbonate is sourced from PubChem (CID 159112216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).