C16H18F4O2 — CID 145420647
(3Z,7Z)-3,4,7,8-tetrafluoro-2,11-dimethoxy-5,6,9-trimethylideneundeca-1,3,7-triene (PubChem CID 145420647) has the molecular formula C16H18F4O2 and a molecular weight of 318.31 g/mol. Its IUPAC name is (3Z,7Z)-3,4,7,8-tetrafluoro-2,11-dimethoxy-5,6,9-trimethylideneundeca-1,3,7-triene.
| Compound Name | (3Z,7Z)-3,4,7,8-tetrafluoro-2,11-dimethoxy-5,6,9-trimethylideneundeca-1,3,7-triene |
|---|---|
| PubChem CID | 145420647 |
| Molecular Formula | C16H18F4O2 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (3Z,7Z)-3,4,7,8-tetrafluoro-2,11-dimethoxy-5,6,9-trimethylideneundeca-1,3,7-triene |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)C(=C)/C(F)=C(\F)C(=C)CCOC |
| InChI | InChI=1S/C16H18F4O2/c1-9(7-8-21-5)13(17)14(18)10(2)11(3)15(19)16(20)12(4)22-6/h1-4,7-8H2,5-6H3/b14-13-,16-15- |
| InChIKey | UYPHEIIJJMGKGX-RFIZXXDFSA-N |
| XLogP | 5.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|