C11H21NO — CID 169113962
5-methoxy-3-methylidene-N-(2-methylpropyl)pentan-2-imine (PubChem CID 169113962) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 5-methoxy-3-methylidene-N-(2-methylpropyl)pentan-2-imine.
| Compound Name | 5-methoxy-3-methylidene-N-(2-methylpropyl)pentan-2-imine |
|---|---|
| PubChem CID | 169113962 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 5-methoxy-3-methylidene-N-(2-methylpropyl)pentan-2-imine |
| SMILES | C=C(CCOC)/C(C)=N/CC(C)C |
| InChI | InChI=1S/C11H21NO/c1-9(2)8-12-11(4)10(3)6-7-13-5/h9H,3,6-8H2,1-2,4-5H3/b12-11+ |
| InChIKey | RMKGTLFAOQMKSU-VAWYXSNFSA-N |
| XLogP | 2.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|