About silyl 3-methoxypropanoate
silyl 3-methoxypropanoate (PubChem CID 175309352) has the molecular formula C4H10O3Si
and a molecular weight of 134.21 g/mol. Its IUPAC name is silyl 3-methoxypropanoate.
Molecular Properties
| Compound Name | silyl 3-methoxypropanoate |
| PubChem CID | 175309352 |
| Molecular Formula | C4H10O3Si |
| Molecular Weight | 134.21 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | silyl 3-methoxypropanoate |
| SMILES | COCCC(=O)O[SiH3] |
| InChI | InChI=1S/C4H10O3Si/c1-6-3-2-4(5)7-8/h2-3H2,1,8H3 |
| InChIKey | LAWXDRJWIMNSIR-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.21 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silyl 3-methoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silyl 3-methoxypropanoate?
The IUPAC name of silyl 3-methoxypropanoate (CID 175309352) is silyl 3-methoxypropanoate.
What is the SMILES notation for silyl 3-methoxypropanoate?
The canonical SMILES for silyl 3-methoxypropanoate is COCCC(=O)O[SiH3].
What is the InChIKey of silyl 3-methoxypropanoate?
The InChIKey is LAWXDRJWIMNSIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3Si/c1-6-3-2-4(5)7-8/h2-3H2,1,8H3.
What are the key properties of silyl 3-methoxypropanoate?
silyl 3-methoxypropanoate has a molecular weight of 134.21 g/mol, XLogP of -1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silyl 3-methoxypropanoate is sourced from PubChem (CID 175309352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).