C35H52O3 — CID 145122378
[(3Z,7Z,11Z)-3-(1-methoxyethenyl)-8,14,17-trimethyl-5,6,9,10,13-pentamethylidenenonadeca-3,7,11-trienyl] formate;2-methylprop-1-ene (PubChem CID 145122378) has the molecular formula C35H52O3 and a molecular weight of 520.80 g/mol. Its IUPAC name is [(3Z,7Z,11Z)-3-(1-methoxyethenyl)-8,14,17-trimethyl-5,6,9,10,13-pentamethylidenenonadeca-3,7,11-trienyl] formate;2-methylprop-1-ene.
| Compound Name | [(3Z,7Z,11Z)-3-(1-methoxyethenyl)-8,14,17-trimethyl-5,6,9,10,13-pentamethylidenenonadeca-3,7,11-trienyl] formate;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145122378 |
| Molecular Formula | C35H52O3 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | [(3Z,7Z,11Z)-3-(1-methoxyethenyl)-8,14,17-trimethyl-5,6,9,10,13-pentamethylidenenonadeca-3,7,11-trienyl] formate;2-methylprop-1-ene |
| SMILES | C=C(/C=C(/C)C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)CC)C(=C)/C=C(/CCOC=O)C(=C)OC.C=C(C)C |
| InChI | InChI=1S/C31H44O3.C4H8/c1-12-22(2)13-14-23(3)24(4)15-16-25(5)29(9)28(8)19-26(6)27(7)20-31(30(10)33-11)17-18-34-21-32;1-4(2)3/h15-16,19-23H,4-7,9-10,12-14,17-18H2,1-3,8,11H3;1H2,2-3H3/b16-15-,28-19-,31-20-; |
| InChIKey | HLIVKVXNVQNKIJ-DFMYDJDNSA-N |
| XLogP | 9.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|