C22H40 — CID 144714644
(Z)-7,10,11,14-tetramethyl-3,6-dimethylidenehexadec-4-ene (PubChem CID 144714644) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is (Z)-7,10,11,14-tetramethyl-3,6-dimethylidenehexadec-4-ene.
| Compound Name | (Z)-7,10,11,14-tetramethyl-3,6-dimethylidenehexadec-4-ene |
|---|---|
| PubChem CID | 144714644 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | (Z)-7,10,11,14-tetramethyl-3,6-dimethylidenehexadec-4-ene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C(C)CCC(C)CC)CC |
| InChI | InChI=1S/C22H40/c1-9-17(3)11-13-19(5)21(7)15-16-22(8)20(6)14-12-18(4)10-2/h11,13,18,20-22H,3,5,9-10,12,14-16H2,1-2,4,6-8H3/b13-11- |
| InChIKey | SLCJSWOSBSDHBY-QBFSEMIESA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|