C15H23N — CID 142297576
(Z)-6,9-dimethyl-2,5-dimethylideneundec-3-enenitrile (PubChem CID 142297576) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (Z)-6,9-dimethyl-2,5-dimethylideneundec-3-enenitrile.
| Compound Name | (Z)-6,9-dimethyl-2,5-dimethylideneundec-3-enenitrile |
|---|---|
| PubChem CID | 142297576 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (Z)-6,9-dimethyl-2,5-dimethylideneundec-3-enenitrile |
| SMILES | C=C(C#N)/C=C\C(=C)C(C)CCC(C)CC |
| InChI | InChI=1S/C15H23N/c1-6-12(2)7-9-14(4)15(5)10-8-13(3)11-16/h8,10,12,14H,3,5-7,9H2,1-2,4H3/b10-8- |
| InChIKey | LCKAMOZWEOYCHM-NTMALXAHSA-N |
| XLogP | 4.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|