C28H44 — CID 145103960
1-[(3Z)-6,9-dimethyl-5-methylideneundeca-1,3-dien-2-yl]-4-(5-methylhept-6-en-2-yl)cyclohexa-1,3-diene (PubChem CID 145103960) has the molecular formula C28H44 and a molecular weight of 380.66 g/mol. Its IUPAC name is 1-[(3Z)-6,9-dimethyl-5-methylideneundeca-1,3-dien-2-yl]-4-(5-methylhept-6-en-2-yl)cyclohexa-1,3-diene.
| Compound Name | 1-[(3Z)-6,9-dimethyl-5-methylideneundeca-1,3-dien-2-yl]-4-(5-methylhept-6-en-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145103960 |
| Molecular Formula | C28H44 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | 1-[(3Z)-6,9-dimethyl-5-methylideneundeca-1,3-dien-2-yl]-4-(5-methylhept-6-en-2-yl)cyclohexa-1,3-diene |
| SMILES | C=CC(C)CCC(C)C1=CC=C(C(=C)/C=C\C(=C)C(C)CCC(C)CC)CC1 |
| InChI | InChI=1S/C28H44/c1-9-21(3)11-13-23(5)24(6)15-16-26(8)28-19-17-27(18-20-28)25(7)14-12-22(4)10-2/h10,15-17,19,21-23,25H,2,6,8-9,11-14,18,20H2,1,3-5,7H3/b16-15- |
| InChIKey | KUHDOLJOPLEVOZ-NXVVXOECSA-N |
| XLogP | 9.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|