C12H20 — CID 144780795
1-methyl-4-pentan-2-ylcyclohexa-1,3-diene (PubChem CID 144780795) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 1-methyl-4-pentan-2-ylcyclohexa-1,3-diene.
| Compound Name | 1-methyl-4-pentan-2-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144780795 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 1-methyl-4-pentan-2-ylcyclohexa-1,3-diene |
| SMILES | CCCC(C)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C12H20/c1-4-5-11(3)12-8-6-10(2)7-9-12/h6,8,11H,4-5,7,9H2,1-3H3 |
| InChIKey | AMAZICNHWHFSCQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |