C19H33Pr- — CID 145474235
1-(5,6-dimethyldecan-2-yl)-4-methylcyclohexa-1,3-diene;praseodymium (PubChem CID 145474235) has the molecular formula C19H33Pr- and a molecular weight of 402.38 g/mol. Its IUPAC name is 1-(5,6-dimethyldecan-2-yl)-4-methylcyclohexa-1,3-diene;praseodymium.
| Compound Name | 1-(5,6-dimethyldecan-2-yl)-4-methylcyclohexa-1,3-diene;praseodymium |
|---|---|
| PubChem CID | 145474235 |
| Molecular Formula | C19H33Pr- |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-(5,6-dimethyldecan-2-yl)-4-methylcyclohexa-1,3-diene;praseodymium |
| SMILES | C[CH-]CCC(C)C(C)CCC(C)C1=CC=C(C)CC1.[Pr] |
| InChI | InChI=1S/C19H33.Pr/c1-6-7-8-16(3)17(4)11-12-18(5)19-13-9-15(2)10-14-19;/h6,9,13,16-18H,7-8,10-12,14H2,1-5H3;/q-1; |
| InChIKey | XWVPAUDAJOXYOB-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|