C31H50O3 — CID 145122433
acetaldehyde;(3Z,7Z,11Z)-2-methoxy-4-(3-methoxypropyl)-7,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;prop-1-ene (PubChem CID 145122433) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is acetaldehyde;(3Z,7Z,11Z)-2-methoxy-4-(3-methoxypropyl)-7,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;prop-1-ene.
| Compound Name | acetaldehyde;(3Z,7Z,11Z)-2-methoxy-4-(3-methoxypropyl)-7,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;prop-1-ene |
|---|---|
| PubChem CID | 145122433 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | acetaldehyde;(3Z,7Z,11Z)-2-methoxy-4-(3-methoxypropyl)-7,10,13-trimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;prop-1-ene |
| SMILES | C=C(/C=C(/CCCOC)C(=C)C(=C)/C(C)=C\C(=C)C(C)/C=C\C(C)CC)OC.C=CC.CC=O |
| InChI | InChI=1S/C26H40O2.C3H6.C2H4O/c1-11-19(2)14-15-20(3)21(4)17-22(5)24(7)25(8)26(13-12-16-27-9)18-23(6)28-10;1-3-2;1-2-3/h14-15,17-20H,4,6-8,11-13,16H2,1-3,5,9-10H3;3H,1H2,2H3;2H,1H3/b15-14-,22-17-,26-18-;; |
| InChIKey | LKCQBKVDKMZURS-UBXCYUQWSA-N |
| XLogP | 8.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|