C32H35F7O — CID 145464239
(3E,7E,11E)-2,3,7,11-tetrafluoro-5,6,9,10-tetramethylidene-13-[(E)-1,1,3-trifluoro-6,9-dimethyl-2,5-dimethylidenedec-3-enoxy]tetradeca-1,3,7,11,13-pentaene (PubChem CID 145464239) has the molecular formula C32H35F7O and a molecular weight of 568.62 g/mol. Its IUPAC name is (3E,7E,11E)-2,3,7,11-tetrafluoro-5,6,9,10-tetramethylidene-13-[(E)-1,1,3-trifluoro-6,9-dimethyl-2,5-dimethylidenedec-3-enoxy]tetradeca-1,3,7,11,13-pentaene.
| Compound Name | (3E,7E,11E)-2,3,7,11-tetrafluoro-5,6,9,10-tetramethylidene-13-[(E)-1,1,3-trifluoro-6,9-dimethyl-2,5-dimethylidenedec-3-enoxy]tetradeca-1,3,7,11,13-pentaene |
|---|---|
| PubChem CID | 145464239 |
| Molecular Formula | C32H35F7O |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | (3E,7E,11E)-2,3,7,11-tetrafluoro-5,6,9,10-tetramethylidene-13-[(E)-1,1,3-trifluoro-6,9-dimethyl-2,5-dimethylidenedec-3-enoxy]tetradeca-1,3,7,11,13-pentaene |
| SMILES | C=C(/C=C(/F)C(=C)C(=C)/C=C(\F)C(=C)C(=C)/C=C(\F)C(=C)F)OC(F)(F)C(=C)/C(F)=C\C(=C)C(C)CCC(C)C |
| InChI | InChI=1S/C32H35F7O/c1-18(2)12-13-19(3)20(4)14-30(36)26(10)32(38,39)40-23(7)17-29(35)25(9)21(5)15-28(34)24(8)22(6)16-31(37)27(11)33/h14-19H,4-13H2,1-3H3/b28-15+,29-17+,30-14+,31-16+ |
| InChIKey | XFMDFEWDLTVDHD-OMASXQTDSA-N |
| XLogP | 11.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|