C14H17FO — CID 145234991
(3Z,7E)-7-fluoro-5,6,9-trimethylideneundeca-1,3,7-trien-2-ol (PubChem CID 145234991) has the molecular formula C14H17FO and a molecular weight of 220.29 g/mol. Its IUPAC name is (3Z,7E)-7-fluoro-5,6,9-trimethylideneundeca-1,3,7-trien-2-ol.
| Compound Name | (3Z,7E)-7-fluoro-5,6,9-trimethylideneundeca-1,3,7-trien-2-ol |
|---|---|
| PubChem CID | 145234991 |
| Molecular Formula | C14H17FO |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (3Z,7E)-7-fluoro-5,6,9-trimethylideneundeca-1,3,7-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)C(=C)/C(F)=C\C(=C)CC |
| InChI | InChI=1S/C14H17FO/c1-6-10(2)9-14(15)13(5)11(3)7-8-12(4)16/h7-9,16H,2-6H2,1H3/b8-7-,14-9+ |
| InChIKey | IMPIMPQYVIFHMD-JEHBAHQJSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|