C21H28F4O — CID 143875087
(3Z,11Z)-2-ethoxy-3,4,11,12-tetrafluoro-6,9,13-trimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraene (PubChem CID 143875087) has the molecular formula C21H28F4O and a molecular weight of 372.45 g/mol. Its IUPAC name is (3Z,11Z)-2-ethoxy-3,4,11,12-tetrafluoro-6,9,13-trimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraene.
| Compound Name | (3Z,11Z)-2-ethoxy-3,4,11,12-tetrafluoro-6,9,13-trimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraene |
|---|---|
| PubChem CID | 143875087 |
| Molecular Formula | C21H28F4O |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (3Z,11Z)-2-ethoxy-3,4,11,12-tetrafluoro-6,9,13-trimethyl-5,10-dimethylidenetetradeca-1,3,11,13-tetraene |
| SMILES | C=C(C)/C(F)=C(/F)C(=C)C(C)CCC(C)C(=C)/C(F)=C(/F)C(=C)OCC |
| InChI | InChI=1S/C21H28F4O/c1-9-26-17(8)21(25)20(24)16(7)14(5)11-10-13(4)15(6)19(23)18(22)12(2)3/h13-14H,2,6-11H2,1,3-5H3/b19-18-,21-20- |
| InChIKey | BEEIKEHQCICTMH-IBNZCFEPSA-N |
| XLogP | 7.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|