C22H27F3O2 — CID 143875132
4-[(1E,8Z)-10-ethoxy-8,9-difluoro-3,6-dimethyl-7-methylideneundeca-1,8,10-trienyl]-2-fluorophenol (PubChem CID 143875132) has the molecular formula C22H27F3O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-[(1E,8Z)-10-ethoxy-8,9-difluoro-3,6-dimethyl-7-methylideneundeca-1,8,10-trienyl]-2-fluorophenol.
| Compound Name | 4-[(1E,8Z)-10-ethoxy-8,9-difluoro-3,6-dimethyl-7-methylideneundeca-1,8,10-trienyl]-2-fluorophenol |
|---|---|
| PubChem CID | 143875132 |
| Molecular Formula | C22H27F3O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 4-[(1E,8Z)-10-ethoxy-8,9-difluoro-3,6-dimethyl-7-methylideneundeca-1,8,10-trienyl]-2-fluorophenol |
| SMILES | C=C(OCC)/C(F)=C(/F)C(=C)C(C)CCC(C)/C=C/c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C22H27F3O2/c1-6-27-17(5)22(25)21(24)16(4)15(3)9-7-14(2)8-10-18-11-12-20(26)19(23)13-18/h8,10-15,26H,4-7,9H2,1-3H3/b10-8+,22-21- |
| InChIKey | KBYHZJJSNGAYHF-MOJFTOGDSA-N |
| XLogP | 6.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|