C21H27F3O — CID 143875246
1-[(7Z)-7,8-difluoro-2,5,9-trimethyl-6-methylidenedeca-7,9-dienoxy]-2-fluoro-4-methylbenzene (PubChem CID 143875246) has the molecular formula C21H27F3O and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[(7Z)-7,8-difluoro-2,5,9-trimethyl-6-methylidenedeca-7,9-dienoxy]-2-fluoro-4-methylbenzene.
| Compound Name | 1-[(7Z)-7,8-difluoro-2,5,9-trimethyl-6-methylidenedeca-7,9-dienoxy]-2-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 143875246 |
| Molecular Formula | C21H27F3O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-[(7Z)-7,8-difluoro-2,5,9-trimethyl-6-methylidenedeca-7,9-dienoxy]-2-fluoro-4-methylbenzene |
| SMILES | C=C(C)/C(F)=C(/F)C(=C)C(C)CCC(C)COc1ccc(C)cc1F |
| InChI | InChI=1S/C21H27F3O/c1-13(2)20(23)21(24)17(6)16(5)9-7-15(4)12-25-19-10-8-14(3)11-18(19)22/h8,10-11,15-16H,1,6-7,9,12H2,2-5H3/b21-20- |
| InChIKey | DKQPJBGCBQKQJA-MRCUWXFGSA-N |
| XLogP | 6.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|