C21H26F4O3 — CID 143875320
4-[(7Z)-9-ethoxy-7,8-difluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-2,3-difluorophenol (PubChem CID 143875320) has the molecular formula C21H26F4O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is 4-[(7Z)-9-ethoxy-7,8-difluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-2,3-difluorophenol.
| Compound Name | 4-[(7Z)-9-ethoxy-7,8-difluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-2,3-difluorophenol |
|---|---|
| PubChem CID | 143875320 |
| Molecular Formula | C21H26F4O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-[(7Z)-9-ethoxy-7,8-difluoro-2,5-dimethyl-6-methylidenedeca-7,9-dienoxy]-2,3-difluorophenol |
| SMILES | C=C(OCC)/C(F)=C(/F)C(=C)C(C)CCC(C)COc1ccc(O)c(F)c1F |
| InChI | InChI=1S/C21H26F4O3/c1-6-27-15(5)19(23)18(22)14(4)13(3)8-7-12(2)11-28-17-10-9-16(26)20(24)21(17)25/h9-10,12-13,26H,4-8,11H2,1-3H3/b19-18- |
| InChIKey | JFTYWYIRQIQXRN-HNENSFHCSA-N |
| XLogP | 6.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|