C32H46F4O2 — CID 70946154
4-[7-[2,3-difluoro-4-(6-methylundecan-3-yl)phenoxy]-6-methylheptan-3-yl]-2,3-difluorophenol (PubChem CID 70946154) has the molecular formula C32H46F4O2 and a molecular weight of 538.71 g/mol. Its IUPAC name is 4-[7-[2,3-difluoro-4-(6-methylundecan-3-yl)phenoxy]-6-methylheptan-3-yl]-2,3-difluorophenol.
| Compound Name | 4-[7-[2,3-difluoro-4-(6-methylundecan-3-yl)phenoxy]-6-methylheptan-3-yl]-2,3-difluorophenol |
|---|---|
| PubChem CID | 70946154 |
| Molecular Formula | C32H46F4O2 |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | 4-[7-[2,3-difluoro-4-(6-methylundecan-3-yl)phenoxy]-6-methylheptan-3-yl]-2,3-difluorophenol |
| SMILES | CCCCCC(C)CCC(CC)c1ccc(OCC(C)CCC(CC)c2ccc(O)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C32H46F4O2/c1-6-9-10-11-21(4)12-14-23(7-2)26-17-19-28(32(36)30(26)34)38-20-22(5)13-15-24(8-3)25-16-18-27(37)31(35)29(25)33/h16-19,21-24,37H,6-15,20H2,1-5H3 |
| InChIKey | PPOSOLKHMQBZLF-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|