C13H19BF2O3 — CID 21477966
[2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid (PubChem CID 21477966) has the molecular formula C13H19BF2O3 and a molecular weight of 272.10 g/mol. Its IUPAC name is [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid.
| Compound Name | [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 21477966 |
| Molecular Formula | C13H19BF2O3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid |
| SMILES | CCCCC(C)COc1ccc(B(O)O)c(F)c1F |
| InChI | InChI=1S/C13H19BF2O3/c1-3-4-5-9(2)8-19-11-7-6-10(14(17)18)12(15)13(11)16/h6-7,9,17-18H,3-5,8H2,1-2H3 |
| InChIKey | QXLWBQNRSSJCPZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|