[2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid

C13H19BF2O3 — CID 21477966

IUPAC[2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid
SMILESCCCCC(C)COc1ccc(B(O)O)c(F)c1F
InChIInChI=1S/C13H19BF2O3/c1-3-4-5-9(2)8-19-11-7-6-10(14(17)18)12(15)13(11)16/h6-7,9,17-18H,3-5,8H2,1-2H3
InChIKeyQXLWBQNRSSJCPZ-UHFFFAOYSA-N
MW272.10 g/mol
LogP1.85
Rot. Bonds7

About [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid

[2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid (PubChem CID 21477966) has the molecular formula C13H19BF2O3 and a molecular weight of 272.10 g/mol. Its IUPAC name is [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid.

Molecular Properties

Compound Name[2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid
PubChem CID21477966
Molecular FormulaC13H19BF2O3
Molecular Weight272.10 g/mol
Exact Mass272.14
IUPAC Name[2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid
SMILESCCCCC(C)COc1ccc(B(O)O)c(F)c1F
InChIInChI=1S/C13H19BF2O3/c1-3-4-5-9(2)8-19-11-7-6-10(14(17)18)12(15)13(11)16/h6-7,9,17-18H,3-5,8H2,1-2H3
InChIKeyQXLWBQNRSSJCPZ-UHFFFAOYSA-N
XLogP1.85
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.10
LogP ≤ 51.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid?
The IUPAC name of [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid (CID 21477966) is [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid.
What is the SMILES notation for [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid?
The canonical SMILES for [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid is CCCCC(C)COc1ccc(B(O)O)c(F)c1F.
What is the InChIKey of [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid?
The InChIKey is QXLWBQNRSSJCPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19BF2O3/c1-3-4-5-9(2)8-19-11-7-6-10(14(17)18)12(15)13(11)16/h6-7,9,17-18H,3-5,8H2,1-2H3.
What are the key properties of [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid?
[2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid has a molecular weight of 272.10 g/mol, XLogP of 1.85, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-difluoro-4-(2-methylhexoxy)phenyl]boronic acid is sourced from PubChem (CID 21477966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).