C32H46F2O3 — CID 67725952
2-[4-[2,3-difluoro-4-(2-methylhexoxy)phenyl]phenyl]-5-nonyl-1,3-dioxane (PubChem CID 67725952) has the molecular formula C32H46F2O3 and a molecular weight of 516.71 g/mol. Its IUPAC name is 2-[4-[2,3-difluoro-4-(2-methylhexoxy)phenyl]phenyl]-5-nonyl-1,3-dioxane.
| Compound Name | 2-[4-[2,3-difluoro-4-(2-methylhexoxy)phenyl]phenyl]-5-nonyl-1,3-dioxane |
|---|---|
| PubChem CID | 67725952 |
| Molecular Formula | C32H46F2O3 |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | 2-[4-[2,3-difluoro-4-(2-methylhexoxy)phenyl]phenyl]-5-nonyl-1,3-dioxane |
| SMILES | CCCCCCCCCC1COC(c2ccc(-c3ccc(OCC(C)CCCC)c(F)c3F)cc2)OC1 |
| InChI | InChI=1S/C32H46F2O3/c1-4-6-8-9-10-11-12-14-25-22-36-32(37-23-25)27-17-15-26(16-18-27)28-19-20-29(31(34)30(28)33)35-21-24(3)13-7-5-2/h15-20,24-25,32H,4-14,21-23H2,1-3H3 |
| InChIKey | PCMCETAGQJFNHS-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|