C25H33BF2O4 — CID 21477958
[2,3-difluoro-4-[4-(5-nonyl-1,3-dioxan-2-yl)phenyl]phenyl]boronic acid (PubChem CID 21477958) has the molecular formula C25H33BF2O4 and a molecular weight of 446.34 g/mol. Its IUPAC name is [2,3-difluoro-4-[4-(5-nonyl-1,3-dioxan-2-yl)phenyl]phenyl]boronic acid.
| Compound Name | [2,3-difluoro-4-[4-(5-nonyl-1,3-dioxan-2-yl)phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 21477958 |
| Molecular Formula | C25H33BF2O4 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | [2,3-difluoro-4-[4-(5-nonyl-1,3-dioxan-2-yl)phenyl]phenyl]boronic acid |
| SMILES | CCCCCCCCCC1COC(c2ccc(-c3ccc(B(O)O)c(F)c3F)cc2)OC1 |
| InChI | InChI=1S/C25H33BF2O4/c1-2-3-4-5-6-7-8-9-18-16-31-25(32-17-18)20-12-10-19(11-13-20)21-14-15-22(26(29)30)24(28)23(21)27/h10-15,18,25,29-30H,2-9,16-17H2,1H3 |
| InChIKey | LWEHHCHNGUZWMT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|