C44H60F2O4 — CID 22000879
2-[4-[2,3-difluoro-4-[4-(4-methyl-5-octyl-1,3-dioxan-2-yl)phenyl]phenyl]phenyl]-4-methyl-5-octyl-1,3-dioxane (PubChem CID 22000879) has the molecular formula C44H60F2O4 and a molecular weight of 690.96 g/mol. Its IUPAC name is 2-[4-[2,3-difluoro-4-[4-(4-methyl-5-octyl-1,3-dioxan-2-yl)phenyl]phenyl]phenyl]-4-methyl-5-octyl-1,3-dioxane.
| Compound Name | 2-[4-[2,3-difluoro-4-[4-(4-methyl-5-octyl-1,3-dioxan-2-yl)phenyl]phenyl]phenyl]-4-methyl-5-octyl-1,3-dioxane |
|---|---|
| PubChem CID | 22000879 |
| Molecular Formula | C44H60F2O4 |
| Molecular Weight | 690.96 g/mol |
| Exact Mass | 690.45 |
| IUPAC Name | 2-[4-[2,3-difluoro-4-[4-(4-methyl-5-octyl-1,3-dioxan-2-yl)phenyl]phenyl]phenyl]-4-methyl-5-octyl-1,3-dioxane |
| SMILES | CCCCCCCCC1COC(c2ccc(-c3ccc(-c4ccc(C5OCC(CCCCCCCC)C(C)O5)cc4)c(F)c3F)cc2)OC1C |
| InChI | InChI=1S/C44H60F2O4/c1-5-7-9-11-13-15-17-37-29-47-43(49-31(37)3)35-23-19-33(20-24-35)39-27-28-40(42(46)41(39)45)34-21-25-36(26-22-34)44-48-30-38(32(4)50-44)18-16-14-12-10-8-6-2/h19-28,31-32,37-38,43-44H,5-18,29-30H2,1-4H3 |
| InChIKey | POVWZGBNIOTHAT-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.96 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|