C31H32F4O3 — CID 88998416
5-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2,3-difluorophenyl]-2-heptyl-1,3-dioxane (PubChem CID 88998416) has the molecular formula C31H32F4O3 and a molecular weight of 528.59 g/mol. Its IUPAC name is 5-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2,3-difluorophenyl]-2-heptyl-1,3-dioxane.
| Compound Name | 5-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2,3-difluorophenyl]-2-heptyl-1,3-dioxane |
|---|---|
| PubChem CID | 88998416 |
| Molecular Formula | C31H32F4O3 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 5-[4-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]phenyl]-2,3-difluorophenyl]-2-heptyl-1,3-dioxane |
| SMILES | CCCCCCCC1OCC(c2ccc(-c3ccc(-c4ccc(C5CO5)c(F)c4F)cc3)c(F)c2F)CO1 |
| InChI | InChI=1S/C31H32F4O3/c1-2-3-4-5-6-7-27-37-16-21(17-38-27)24-13-12-22(28(32)30(24)34)19-8-10-20(11-9-19)23-14-15-25(26-18-36-26)31(35)29(23)33/h8-15,21,26-27H,2-7,16-18H2,1H3 |
| InChIKey | UPOPIQPFHDUOTB-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|