C34H52O3 — CID 22842982
2-[4-[4-[(6S)-6-methyloctoxy]phenyl]phenyl]-5-nonyl-1,3-dioxane (PubChem CID 22842982) has the molecular formula C34H52O3 and a molecular weight of 508.79 g/mol. Its IUPAC name is 2-[4-[4-[(6S)-6-methyloctoxy]phenyl]phenyl]-5-nonyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[(6S)-6-methyloctoxy]phenyl]phenyl]-5-nonyl-1,3-dioxane |
|---|---|
| PubChem CID | 22842982 |
| Molecular Formula | C34H52O3 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.39 |
| IUPAC Name | 2-[4-[4-[(6S)-6-methyloctoxy]phenyl]phenyl]-5-nonyl-1,3-dioxane |
| SMILES | CCCCCCCCCC1COC(c2ccc(-c3ccc(OCCCCC[C@@H](C)CC)cc3)cc2)OC1 |
| InChI | InChI=1S/C34H52O3/c1-4-6-7-8-9-10-13-16-29-26-36-34(37-27-29)32-19-17-30(18-20-32)31-21-23-33(24-22-31)35-25-14-11-12-15-28(3)5-2/h17-24,28-29,34H,4-16,25-27H2,1-3H3/t28-,29?,34?/m0/s1 |
| InChIKey | QURZMDXMZQLIQZ-VJVUOHSHSA-N |
| XLogP | 10.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|