C32H48O3 — CID 67780173
2-[4-[4-[(4S)-4-methylhexoxy]phenyl]phenyl]-5-nonyl-1,3-dioxane (PubChem CID 67780173) has the molecular formula C32H48O3 and a molecular weight of 480.73 g/mol. Its IUPAC name is 2-[4-[4-[(4S)-4-methylhexoxy]phenyl]phenyl]-5-nonyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[(4S)-4-methylhexoxy]phenyl]phenyl]-5-nonyl-1,3-dioxane |
|---|---|
| PubChem CID | 67780173 |
| Molecular Formula | C32H48O3 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | 2-[4-[4-[(4S)-4-methylhexoxy]phenyl]phenyl]-5-nonyl-1,3-dioxane |
| SMILES | CCCCCCCCCC1COC(c2ccc(-c3ccc(OCCC[C@@H](C)CC)cc3)cc2)OC1 |
| InChI | InChI=1S/C32H48O3/c1-4-6-7-8-9-10-11-14-27-24-34-32(35-25-27)30-17-15-28(16-18-30)29-19-21-31(22-20-29)33-23-12-13-26(3)5-2/h15-22,26-27,32H,4-14,23-25H2,1-3H3/t26-,27?,32?/m0/s1 |
| InChIKey | GCCZKMZNPSKLEO-GEDHVSJLSA-N |
| XLogP | 9.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|