C10H11BF2O3 — CID 175240285
(4-but-2-enoxy-2,3-difluorophenyl)boronic acid (PubChem CID 175240285) has the molecular formula C10H11BF2O3 and a molecular weight of 228.00 g/mol. Its IUPAC name is (4-but-2-enoxy-2,3-difluorophenyl)boronic acid.
| Compound Name | (4-but-2-enoxy-2,3-difluorophenyl)boronic acid |
|---|---|
| PubChem CID | 175240285 |
| Molecular Formula | C10H11BF2O3 |
| Molecular Weight | 228.00 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | (4-but-2-enoxy-2,3-difluorophenyl)boronic acid |
| SMILES | CC=CCOc1ccc(B(O)O)c(F)c1F |
| InChI | InChI=1S/C10H11BF2O3/c1-2-3-6-16-8-5-4-7(11(14)15)9(12)10(8)13/h2-5,14-15H,6H2,1H3 |
| InChIKey | BNYHNONOYHYNPQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.00 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|