C11H12F2O — CID 130512826
1-[(E)-but-2-enoxy]-4,5-difluoro-2-methylbenzene (PubChem CID 130512826) has the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. Its IUPAC name is 1-[(E)-but-2-enoxy]-4,5-difluoro-2-methylbenzene.
| Compound Name | 1-[(E)-but-2-enoxy]-4,5-difluoro-2-methylbenzene |
|---|---|
| PubChem CID | 130512826 |
| Molecular Formula | C11H12F2O |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-[(E)-but-2-enoxy]-4,5-difluoro-2-methylbenzene |
| SMILES | C/C=C/COc1cc(F)c(F)cc1C |
| InChI | InChI=1S/C11H12F2O/c1-3-4-5-14-11-7-10(13)9(12)6-8(11)2/h3-4,6-7H,5H2,1-2H3/b4-3+ |
| InChIKey | VRBOCEQBDYQJOD-ONEGZZNKSA-N |
| XLogP | 3.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|