C15H23NO3S — CID 82914387
4-[(E)-but-2-enoxy]-5-tert-butyl-2-methylbenzenesulfonamide (PubChem CID 82914387) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 4-[(E)-but-2-enoxy]-5-tert-butyl-2-methylbenzenesulfonamide.
| Compound Name | 4-[(E)-but-2-enoxy]-5-tert-butyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 82914387 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-[(E)-but-2-enoxy]-5-tert-butyl-2-methylbenzenesulfonamide |
| SMILES | C/C=C/COc1cc(C)c(S(N)(=O)=O)cc1C(C)(C)C |
| InChI | InChI=1S/C15H23NO3S/c1-6-7-8-19-13-9-11(2)14(20(16,17)18)10-12(13)15(3,4)5/h6-7,9-10H,8H2,1-5H3,(H2,16,17,18)/b7-6+ |
| InChIKey | VVIJHAGZSYYVJR-VOTSOKGWSA-N |
| XLogP | 2.89 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|