C14H21NO3S — CID 82919148
4-[(E)-but-2-enoxy]-5-methyl-2-propan-2-ylbenzenesulfonamide (PubChem CID 82919148) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-[(E)-but-2-enoxy]-5-methyl-2-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[(E)-but-2-enoxy]-5-methyl-2-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 82919148 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-[(E)-but-2-enoxy]-5-methyl-2-propan-2-ylbenzenesulfonamide |
| SMILES | C/C=C/COc1cc(C(C)C)c(S(N)(=O)=O)cc1C |
| InChI | InChI=1S/C14H21NO3S/c1-5-6-7-18-13-9-12(10(2)3)14(8-11(13)4)19(15,16)17/h5-6,8-10H,7H2,1-4H3,(H2,15,16,17)/b6-5+ |
| InChIKey | YZROFWZSEWKXOS-AATRIKPKSA-N |
| XLogP | 2.72 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|