C10H11F2NO — CID 131235553
5-[(E)-but-2-enoxy]-2,4-difluoroaniline (PubChem CID 131235553) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 5-[(E)-but-2-enoxy]-2,4-difluoroaniline.
| Compound Name | 5-[(E)-but-2-enoxy]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 131235553 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 5-[(E)-but-2-enoxy]-2,4-difluoroaniline |
| SMILES | C/C=C/COc1cc(N)c(F)cc1F |
| InChI | InChI=1S/C10H11F2NO/c1-2-3-4-14-10-6-9(13)7(11)5-8(10)12/h2-3,5-6H,4,13H2,1H3/b3-2+ |
| InChIKey | ZKFAJXCGLZAOQB-NSCUHMNNSA-N |
| XLogP | 2.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|